About diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate
diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate (PubChem CID 158311966) has the molecular formula C18H29NO9
and a molecular weight of 403.43 g/mol. Its IUPAC name is diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate |
| PubChem CID | 158311966 |
| Molecular Formula | C18H29NO9 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate |
| SMILES | CCOC(=O)C(=CN)C(=O)OCC.CCOC=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C10H16O5.C8H13NO4/c1-4-13-7-8(9(11)14-5-2)10(12)15-6-3;1-3-12-7(10)6(5-9)8(11)13-4-2/h7H,4-6H2,1-3H3;5H,3-4,9H2,1-2H3 |
| InChIKey | GNUBQQRIFVFDMN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate?
The IUPAC name of diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate (CID 158311966) is diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate.
What is the SMILES notation for diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate?
The canonical SMILES for diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate is CCOC(=O)C(=CN)C(=O)OCC.CCOC=C(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate?
The InChIKey is GNUBQQRIFVFDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5.C8H13NO4/c1-4-13-7-8(9(11)14-5-2)10(12)15-6-3;1-3-12-7(10)6(5-9)8(11)13-4-2/h7H,4-6H2,1-3H3;5H,3-4,9H2,1-2H3.
What are the key properties of diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate?
diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate has a molecular weight of 403.43 g/mol, XLogP of 0.99, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(aminomethylidene)propanedioate;diethyl 2-(ethoxymethylidene)propanedioate is sourced from PubChem (CID 158311966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).