C9H11BrF2O4 — CID 154747063
ethyl 4-bromo-2-(ethoxymethylidene)-4,4-difluoro-3-oxobutanoate (PubChem CID 154747063) has the molecular formula C9H11BrF2O4 and a molecular weight of 301.08 g/mol. Its IUPAC name is ethyl 4-bromo-2-(ethoxymethylidene)-4,4-difluoro-3-oxobutanoate.
| Compound Name | ethyl 4-bromo-2-(ethoxymethylidene)-4,4-difluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 154747063 |
| Molecular Formula | C9H11BrF2O4 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | ethyl 4-bromo-2-(ethoxymethylidene)-4,4-difluoro-3-oxobutanoate |
| SMILES | CCOC=C(C(=O)OCC)C(=O)C(F)(F)Br |
| InChI | InChI=1S/C9H11BrF2O4/c1-3-15-5-6(8(14)16-4-2)7(13)9(10,11)12/h5H,3-4H2,1-2H3 |
| InChIKey | ZQSXTLWQYJQEFQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|