C9H9F3O3 — CID 134983172
ethyl (2E)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate (PubChem CID 134983172) has the molecular formula C9H9F3O3 and a molecular weight of 222.16 g/mol. Its IUPAC name is ethyl (2E)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate.
| Compound Name | ethyl (2E)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 134983172 |
| Molecular Formula | C9H9F3O3 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | ethyl (2E)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienoate |
| SMILES | C=C/C=C(/C(=O)OCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3O3/c1-3-5-6(8(14)15-4-2)7(13)9(10,11)12/h3,5H,1,4H2,2H3/b6-5+ |
| InChIKey | RIRQZECHWJZDBO-AATRIKPKSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|