C15H18F6O7 — CID 160938422
ethyl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate;ethyl 4,4,4-trifluoro-3-oxobutanoate (PubChem CID 160938422) has the molecular formula C15H18F6O7 and a molecular weight of 424.29 g/mol. Its IUPAC name is ethyl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate;ethyl 4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate;ethyl 4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 160938422 |
| Molecular Formula | C15H18F6O7 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | ethyl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate;ethyl 4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)C(F)(F)F.CCOC=C(C(=O)OCC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O4.C6H7F3O3/c1-3-15-5-6(8(14)16-4-2)7(13)9(10,11)12;1-2-12-5(11)3-4(10)6(7,8)9/h5H,3-4H2,1-2H3;2-3H2,1H3 |
| InChIKey | SUEHJCHFGYCEME-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|