C11H15F3O4 — CID 151787281
butan-2-yl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 151787281) has the molecular formula C11H15F3O4 and a molecular weight of 268.23 g/mol. Its IUPAC name is butan-2-yl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | butan-2-yl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 151787281 |
| Molecular Formula | C11H15F3O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | butan-2-yl 2-(ethoxymethylidene)-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC=C(C(=O)OC(C)CC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O4/c1-4-7(3)18-10(16)8(6-17-5-2)9(15)11(12,13)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | RVWMZVNTMGCNHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|