C10H10F6O3 — CID 57195694
3-(butan-2-yloxymethylidene)-1,1,1,5,5,5-hexafluoropentane-2,4-dione (PubChem CID 57195694) has the molecular formula C10H10F6O3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 3-(butan-2-yloxymethylidene)-1,1,1,5,5,5-hexafluoropentane-2,4-dione.
| Compound Name | 3-(butan-2-yloxymethylidene)-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 57195694 |
| Molecular Formula | C10H10F6O3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(butan-2-yloxymethylidene)-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| SMILES | CCC(C)OC=C(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O3/c1-3-5(2)19-4-6(7(17)9(11,12)13)8(18)10(14,15)16/h4-5H,3H2,1-2H3 |
| InChIKey | HFRGFWVALMKXBO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|