C12H17F6NO3 — CID 159940751
N,N-diethyl-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159940751) has the molecular formula C12H17F6NO3 and a molecular weight of 337.26 g/mol. Its IUPAC name is N,N-diethyl-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N,N-diethyl-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159940751 |
| Molecular Formula | C12H17F6NO3 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N,N-diethyl-2-methylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CCN(CC)C(=O)C(C)C.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H17NO.C4F6O2/c1-5-9(6-2)8(10)7(3)4;5-3(6,7)1(11)2(12)4(8,9)10/h7H,5-6H2,1-4H3; |
| InChIKey | OAVPCJFEJZZWSX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|