C10H18F3NO — CID 62491296
N-ethyl-N-(2-ethylbutyl)-2,2,2-trifluoroacetamide (PubChem CID 62491296) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is N-ethyl-N-(2-ethylbutyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-ethyl-N-(2-ethylbutyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62491296 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-ethyl-N-(2-ethylbutyl)-2,2,2-trifluoroacetamide |
| SMILES | CCC(CC)CN(CC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-4-8(5-2)7-14(6-3)9(15)10(11,12)13/h8H,4-7H2,1-3H3 |
| InChIKey | SHLMYAMQTVMJFC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |