C13H27NO — CID 62735136
N-ethyl-N-(2-ethylbutyl)-2,2-dimethylpropanamide (PubChem CID 62735136) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-ethyl-N-(2-ethylbutyl)-2,2-dimethylpropanamide.
| Compound Name | N-ethyl-N-(2-ethylbutyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62735136 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-ethyl-N-(2-ethylbutyl)-2,2-dimethylpropanamide |
| SMILES | CCC(CC)CN(CC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-11(8-2)10-14(9-3)12(15)13(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | OQXGBDCCBPVUAQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |