C14H30N2O — CID 61156136
(2S)-2-amino-N-ethyl-N-(2-ethylbutyl)-3,3-dimethylbutanamide (PubChem CID 61156136) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is (2S)-2-amino-N-ethyl-N-(2-ethylbutyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-ethyl-N-(2-ethylbutyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 61156136 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | (2S)-2-amino-N-ethyl-N-(2-ethylbutyl)-3,3-dimethylbutanamide |
| SMILES | CCC(CC)CN(CC)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-7-11(8-2)10-16(9-3)13(17)12(15)14(4,5)6/h11-12H,7-10,15H2,1-6H3/t12-/m1/s1 |
| InChIKey | KMYJFJBAFPKWJQ-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |