C9H20N2O — CID 61154665
(2S)-2-amino-N-ethyl-N,3,3-trimethylbutanamide (PubChem CID 61154665) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (2S)-2-amino-N-ethyl-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-amino-N-ethyl-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 61154665 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (2S)-2-amino-N-ethyl-N,3,3-trimethylbutanamide |
| SMILES | CCN(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C9H20N2O/c1-6-11(5)8(12)7(10)9(2,3)4/h7H,6,10H2,1-5H3/t7-/m1/s1 |
| InChIKey | KWVGQOFWUWQQCV-SSDOTTSWSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |