C15H30N2O3 — CID 142813797
(E)-4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2-methylbut-2-enoic acid;propane (PubChem CID 142813797) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is (E)-4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2-methylbut-2-enoic acid;propane.
| Compound Name | (E)-4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2-methylbut-2-enoic acid;propane |
|---|---|
| PubChem CID | 142813797 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (E)-4-[(2-amino-3,3-dimethylbutanoyl)-methylamino]-2-methylbut-2-enoic acid;propane |
| SMILES | C/C(=C\CN(C)C(=O)C(N)C(C)(C)C)C(=O)O.CCC |
| InChI | InChI=1S/C12H22N2O3.C3H8/c1-8(11(16)17)6-7-14(5)10(15)9(13)12(2,3)4;1-3-2/h6,9H,7,13H2,1-5H3,(H,16,17);3H2,1-2H3/b8-6+; |
| InChIKey | FASBLYBWDJVIDU-WVLIHFOGSA-N |
| XLogP | 2.27 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|