C6H11NO3 — CID 131276688
(Z)-4-[hydroxy(methyl)amino]-2-methylbut-2-enoic acid (PubChem CID 131276688) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is (Z)-4-[hydroxy(methyl)amino]-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-[hydroxy(methyl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 131276688 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (Z)-4-[hydroxy(methyl)amino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C/CN(C)O)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-5(6(8)9)3-4-7(2)10/h3,10H,4H2,1-2H3,(H,8,9)/b5-3- |
| InChIKey | VJEJYGRHGMSHJZ-HYXAFXHYSA-N |
| XLogP | 0.34 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|