C13H31ClN2O2 — CID 173034398
bis(N,N-dimethylmethanamine);2-methylhex-2-enoic acid;hydrochloride (PubChem CID 173034398) has the molecular formula C13H31ClN2O2 and a molecular weight of 282.86 g/mol. Its IUPAC name is bis(N,N-dimethylmethanamine);2-methylhex-2-enoic acid;hydrochloride.
| Compound Name | bis(N,N-dimethylmethanamine);2-methylhex-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 173034398 |
| Molecular Formula | C13H31ClN2O2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | bis(N,N-dimethylmethanamine);2-methylhex-2-enoic acid;hydrochloride |
| SMILES | CCCC=C(C)C(=O)O.CN(C)C.CN(C)C.Cl |
| InChI | InChI=1S/C7H12O2.2C3H9N.ClH/c1-3-4-5-6(2)7(8)9;2*1-4(2)3;/h5H,3-4H2,1-2H3,(H,8,9);2*1-3H3;1H |
| InChIKey | LPVMOKUIWJZERA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|