C7H11NO3 — CID 142813747
(E)-4-[formyl(methyl)amino]-2-methylbut-2-enoic acid (PubChem CID 142813747) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (E)-4-[formyl(methyl)amino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[formyl(methyl)amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 142813747 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (E)-4-[formyl(methyl)amino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CN(C)C=O)C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-6(7(10)11)3-4-8(2)5-9/h3,5H,4H2,1-2H3,(H,10,11)/b6-3+ |
| InChIKey | IDYAPYAGRMWNPI-ZZXKWVIFSA-N |
| XLogP | 0.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|