C17H29FN2O4 — CID 145131420
(E)-4-[[2-[(3-fluoro-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoic acid (PubChem CID 145131420) has the molecular formula C17H29FN2O4 and a molecular weight of 344.43 g/mol. Its IUPAC name is (E)-4-[[2-[(3-fluoro-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[[2-[(3-fluoro-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 145131420 |
| Molecular Formula | C17H29FN2O4 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (E)-4-[[2-[(3-fluoro-3-methylbutanoyl)amino]-3,3-dimethylbutanoyl]-methylamino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CN(C)C(=O)C(NC(=O)CC(C)(C)F)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H29FN2O4/c1-11(15(23)24)8-9-20(7)14(22)13(16(2,3)4)19-12(21)10-17(5,6)18/h8,13H,9-10H2,1-7H3,(H,19,21)(H,23,24)/b11-8+ |
| InChIKey | BPNASNLNZCLSEE-DHZHZOJOSA-N |
| XLogP | 2.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|