C15H30N4O2 — CID 142814026
N-[(E)-4-amino-3-methylbut-2-enyl]-N,3,3-trimethyl-2-[[2-(methylamino)acetyl]amino]butanamide (PubChem CID 142814026) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[(E)-4-amino-3-methylbut-2-enyl]-N,3,3-trimethyl-2-[[2-(methylamino)acetyl]amino]butanamide.
| Compound Name | N-[(E)-4-amino-3-methylbut-2-enyl]-N,3,3-trimethyl-2-[[2-(methylamino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 142814026 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | N-[(E)-4-amino-3-methylbut-2-enyl]-N,3,3-trimethyl-2-[[2-(methylamino)acetyl]amino]butanamide |
| SMILES | CNCC(=O)NC(C(=O)N(C)C/C=C(\C)CN)C(C)(C)C |
| InChI | InChI=1S/C15H30N4O2/c1-11(9-16)7-8-19(6)14(21)13(15(2,3)4)18-12(20)10-17-5/h7,13,17H,8-10,16H2,1-6H3,(H,18,20)/b11-7+ |
| InChIKey | QLDJORQPNWQLHL-YRNVUSSQSA-N |
| XLogP | 0.10 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|