C21H41N3O4S — CID 143023652
(E)-4-[[3,3-dimethyl-2-[[2-methyl-2-(methylamino)-4-sulfanylbutanoyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid;propane (PubChem CID 143023652) has the molecular formula C21H41N3O4S and a molecular weight of 431.64 g/mol. Its IUPAC name is (E)-4-[[3,3-dimethyl-2-[[2-methyl-2-(methylamino)-4-sulfanylbutanoyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid;propane.
| Compound Name | (E)-4-[[3,3-dimethyl-2-[[2-methyl-2-(methylamino)-4-sulfanylbutanoyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid;propane |
|---|---|
| PubChem CID | 143023652 |
| Molecular Formula | C21H41N3O4S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (E)-4-[[3,3-dimethyl-2-[[2-methyl-2-(methylamino)-4-sulfanylbutanoyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid;propane |
| SMILES | CCC.CNC(C)(CCS)C(=O)NC(C(=O)N(C)C/C=C(\C)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C18H33N3O4S.C3H8/c1-12(15(23)24)8-10-21(7)14(22)13(17(2,3)4)20-16(25)18(5,19-6)9-11-26;1-3-2/h8,13,19,26H,9-11H2,1-7H3,(H,20,25)(H,23,24);3H2,1-2H3/b12-8+; |
| InChIKey | OCHIBFHADXYIFS-MXZHIVQLSA-N |
| XLogP | 2.72 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|