C18H31N3O4 — CID 166894968
(E)-4-[[3,3-dimethyl-2-[[(2R)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid (PubChem CID 166894968) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is (E)-4-[[3,3-dimethyl-2-[[(2R)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-[[3,3-dimethyl-2-[[(2R)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 166894968 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (E)-4-[[3,3-dimethyl-2-[[(2R)-piperidine-2-carbonyl]amino]butanoyl]-methylamino]-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\CN(C)C(=O)C(NC(=O)[C@H]1CCCCN1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H31N3O4/c1-12(17(24)25)9-11-21(5)16(23)14(18(2,3)4)20-15(22)13-8-6-7-10-19-13/h9,13-14,19H,6-8,10-11H2,1-5H3,(H,20,22)(H,24,25)/b12-9+/t13-,14?/m1/s1 |
| InChIKey | LGBUSLDAAFYHNO-GVEPNAFVSA-N |
| XLogP | 1.15 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|