C12H22Cl4N2O2 — CID 141409453
2,2-dichloro-N,N-diethylacetamide (PubChem CID 141409453) has the molecular formula C12H22Cl4N2O2 and a molecular weight of 368.13 g/mol. Its IUPAC name is 2,2-dichloro-N,N-diethylacetamide.
| Compound Name | 2,2-dichloro-N,N-diethylacetamide |
|---|---|
| PubChem CID | 141409453 |
| Molecular Formula | C12H22Cl4N2O2 |
| Molecular Weight | 368.13 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2,2-dichloro-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)Cl.CCN(CC)C(=O)C(Cl)Cl |
| InChI | InChI=1S/2C6H11Cl2NO/c2*1-3-9(4-2)6(10)5(7)8/h2*5H,3-4H2,1-2H3 |
| InChIKey | XDBMKMWAMDQGSW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|