C12H24Cl2N2O2 — CID 174887176
2,2-dichloro-N,N-diethylacetamide;N,N-diethylacetamide (PubChem CID 174887176) has the molecular formula C12H24Cl2N2O2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 2,2-dichloro-N,N-diethylacetamide;N,N-diethylacetamide.
| Compound Name | 2,2-dichloro-N,N-diethylacetamide;N,N-diethylacetamide |
|---|---|
| PubChem CID | 174887176 |
| Molecular Formula | C12H24Cl2N2O2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,2-dichloro-N,N-diethylacetamide;N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)Cl.CCN(CC)C(C)=O |
| InChI | InChI=1S/C6H11Cl2NO.C6H13NO/c1-3-9(4-2)6(10)5(7)8;1-4-7(5-2)6(3)8/h5H,3-4H2,1-2H3;4-5H2,1-3H3 |
| InChIKey | OOQKJUQJOVMIAF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|