C7H8Cl5NO — CID 20554032
2,2-dichloro-N-ethyl-N-(2,3,3-trichloroprop-2-enyl)acetamide (PubChem CID 20554032) has the molecular formula C7H8Cl5NO and a molecular weight of 299.41 g/mol. Its IUPAC name is 2,2-dichloro-N-ethyl-N-(2,3,3-trichloroprop-2-enyl)acetamide.
| Compound Name | 2,2-dichloro-N-ethyl-N-(2,3,3-trichloroprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 20554032 |
| Molecular Formula | C7H8Cl5NO |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 296.90 |
| IUPAC Name | 2,2-dichloro-N-ethyl-N-(2,3,3-trichloroprop-2-enyl)acetamide |
| SMILES | CCN(CC(Cl)=C(Cl)Cl)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C7H8Cl5NO/c1-2-13(7(14)6(11)12)3-4(8)5(9)10/h6H,2-3H2,1H3 |
| InChIKey | OGYFRRMLHDSVDP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|