C4H6Cl3NO — CID 88809029
N,2,2-trichloro-N-ethylacetamide (PubChem CID 88809029) has the molecular formula C4H6Cl3NO and a molecular weight of 190.46 g/mol. Its IUPAC name is N,2,2-trichloro-N-ethylacetamide.
| Compound Name | N,2,2-trichloro-N-ethylacetamide |
|---|---|
| PubChem CID | 88809029 |
| Molecular Formula | C4H6Cl3NO |
| Molecular Weight | 190.46 g/mol |
| Exact Mass | 188.95 |
| IUPAC Name | N,2,2-trichloro-N-ethylacetamide |
| SMILES | CCN(Cl)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C4H6Cl3NO/c1-2-8(7)4(9)3(5)6/h3H,2H2,1H3 |
| InChIKey | LIVCGYWYDKQVLI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|