C9H18ClNO — CID 62224091
2-chloro-N,N-diethylpentanamide (PubChem CID 62224091) has the molecular formula C9H18ClNO and a molecular weight of 191.70 g/mol. Its IUPAC name is 2-chloro-N,N-diethylpentanamide.
| Compound Name | 2-chloro-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 62224091 |
| Molecular Formula | C9H18ClNO |
| Molecular Weight | 191.70 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-chloro-N,N-diethylpentanamide |
| SMILES | CCCC(Cl)C(=O)N(CC)CC |
| InChI | InChI=1S/C9H18ClNO/c1-4-7-8(10)9(12)11(5-2)6-3/h8H,4-7H2,1-3H3 |
| InChIKey | GZAJCICKTWBAAE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.70 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|