C7H15NO2S — CID 86078182
N,N-diethyl-2-hydroxy-3-sulfanylpropanamide (PubChem CID 86078182) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is N,N-diethyl-2-hydroxy-3-sulfanylpropanamide.
| Compound Name | N,N-diethyl-2-hydroxy-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 86078182 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | N,N-diethyl-2-hydroxy-3-sulfanylpropanamide |
| SMILES | CCN(CC)C(=O)C(O)CS |
| InChI | InChI=1S/C7H15NO2S/c1-3-8(4-2)7(10)6(9)5-11/h6,9,11H,3-5H2,1-2H3 |
| InChIKey | WOKHDKJEMDHTJU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|