C8H17NO2Se — CID 141469545
N,N-diethyl-2-hydroxy-3-methylselanylpropanamide (PubChem CID 141469545) has the molecular formula C8H17NO2Se and a molecular weight of 238.19 g/mol. Its IUPAC name is N,N-diethyl-2-hydroxy-3-methylselanylpropanamide.
| Compound Name | N,N-diethyl-2-hydroxy-3-methylselanylpropanamide |
|---|---|
| PubChem CID | 141469545 |
| Molecular Formula | C8H17NO2Se |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N,N-diethyl-2-hydroxy-3-methylselanylpropanamide |
| SMILES | CCN(CC)C(=O)C(O)C[Se]C |
| InChI | InChI=1S/C8H17NO2Se/c1-4-9(5-2)8(11)7(10)6-12-3/h7,10H,4-6H2,1-3H3 |
| InChIKey | RHIQXAPEEMOCAV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|