C7H13Br2NO — CID 86249575
2,3-dibromo-N,N-diethylpropanamide (PubChem CID 86249575) has the molecular formula C7H13Br2NO and a molecular weight of 287.00 g/mol. Its IUPAC name is 2,3-dibromo-N,N-diethylpropanamide.
| Compound Name | 2,3-dibromo-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 86249575 |
| Molecular Formula | C7H13Br2NO |
| Molecular Weight | 287.00 g/mol |
| Exact Mass | 284.94 |
| IUPAC Name | 2,3-dibromo-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(Br)CBr |
| InChI | InChI=1S/C7H13Br2NO/c1-3-10(4-2)7(11)6(9)5-8/h6H,3-5H2,1-2H3 |
| InChIKey | QKIKBCJEIGZPQM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.00 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|