About 1,2-dibromopentan-3-one
1,2-dibromopentan-3-one (PubChem CID 15193415) has the molecular formula C5H8Br2O
and a molecular weight of 243.93 g/mol. Its IUPAC name is 1,2-dibromopentan-3-one.
Molecular Properties
| Compound Name | 1,2-dibromopentan-3-one |
| PubChem CID | 15193415 |
| Molecular Formula | C5H8Br2O |
| Molecular Weight | 243.93 g/mol |
| Exact Mass | 241.89 |
| IUPAC Name | 1,2-dibromopentan-3-one |
| SMILES | CCC(=O)C(Br)CBr |
| InChI | InChI=1S/C5H8Br2O/c1-2-5(8)4(7)3-6/h4H,2-3H2,1H3 |
| InChIKey | MGUUXGZTJGZSDH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.93 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromopentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromopentan-3-one?
The IUPAC name of 1,2-dibromopentan-3-one (CID 15193415) is 1,2-dibromopentan-3-one.
What is the SMILES notation for 1,2-dibromopentan-3-one?
The canonical SMILES for 1,2-dibromopentan-3-one is CCC(=O)C(Br)CBr.
What is the InChIKey of 1,2-dibromopentan-3-one?
The InChIKey is MGUUXGZTJGZSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Br2O/c1-2-5(8)4(7)3-6/h4H,2-3H2,1H3.
What are the key properties of 1,2-dibromopentan-3-one?
1,2-dibromopentan-3-one has a molecular weight of 243.93 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromopentan-3-one is sourced from PubChem (CID 15193415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).