C5H8Br2O — CID 15193415
1,2-dibromopentan-3-one (PubChem CID 15193415) has the molecular formula C5H8Br2O and a molecular weight of 243.93 g/mol. Its IUPAC name is 1,2-dibromopentan-3-one.
| Compound Name | 1,2-dibromopentan-3-one |
|---|---|
| PubChem CID | 15193415 |
| Molecular Formula | C5H8Br2O |
| Molecular Weight | 243.93 g/mol |
| Exact Mass | 241.89 |
| IUPAC Name | 1,2-dibromopentan-3-one |
| SMILES | CCC(=O)C(Br)CBr |
| InChI | InChI=1S/C5H8Br2O/c1-2-5(8)4(7)3-6/h4H,2-3H2,1H3 |
| InChIKey | MGUUXGZTJGZSDH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.93 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|