About (3,4-dibromo-2-oxobutyl) acetate
(3,4-dibromo-2-oxobutyl) acetate (PubChem CID 119097688) has the molecular formula C6H8Br2O3
and a molecular weight of 287.94 g/mol. Its IUPAC name is (3,4-dibromo-2-oxobutyl) acetate.
Molecular Properties
| Compound Name | (3,4-dibromo-2-oxobutyl) acetate |
| PubChem CID | 119097688 |
| Molecular Formula | C6H8Br2O3 |
| Molecular Weight | 287.94 g/mol |
| Exact Mass | 285.88 |
| IUPAC Name | (3,4-dibromo-2-oxobutyl) acetate |
| SMILES | CC(=O)OCC(=O)C(Br)CBr |
| InChI | InChI=1S/C6H8Br2O3/c1-4(9)11-3-6(10)5(8)2-7/h5H,2-3H2,1H3 |
| InChIKey | SCKDAVKBXYIXOU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.94 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dibromo-2-oxobutyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dibromo-2-oxobutyl) acetate?
The IUPAC name of (3,4-dibromo-2-oxobutyl) acetate (CID 119097688) is (3,4-dibromo-2-oxobutyl) acetate.
What is the SMILES notation for (3,4-dibromo-2-oxobutyl) acetate?
The canonical SMILES for (3,4-dibromo-2-oxobutyl) acetate is CC(=O)OCC(=O)C(Br)CBr.
What is the InChIKey of (3,4-dibromo-2-oxobutyl) acetate?
The InChIKey is SCKDAVKBXYIXOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2O3/c1-4(9)11-3-6(10)5(8)2-7/h5H,2-3H2,1H3.
What are the key properties of (3,4-dibromo-2-oxobutyl) acetate?
(3,4-dibromo-2-oxobutyl) acetate has a molecular weight of 287.94 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dibromo-2-oxobutyl) acetate is sourced from PubChem (CID 119097688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).