About methanol;2-oxopropyl acetate
methanol;2-oxopropyl acetate (PubChem CID 174729097) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is methanol;2-oxopropyl acetate.
Molecular Properties
| Compound Name | methanol;2-oxopropyl acetate |
| PubChem CID | 174729097 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | methanol;2-oxopropyl acetate |
| SMILES | CC(=O)COC(C)=O.CO |
| InChI | InChI=1S/C5H8O3.CH4O/c1-4(6)3-8-5(2)7;1-2/h3H2,1-2H3;2H,1H3 |
| InChIKey | DUVMZRWJSXQCHR-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanol;2-oxopropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-oxopropyl acetate?
The IUPAC name of methanol;2-oxopropyl acetate (CID 174729097) is methanol;2-oxopropyl acetate.
What is the SMILES notation for methanol;2-oxopropyl acetate?
The canonical SMILES for methanol;2-oxopropyl acetate is CC(=O)COC(C)=O.CO.
What is the InChIKey of methanol;2-oxopropyl acetate?
The InChIKey is DUVMZRWJSXQCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.CH4O/c1-4(6)3-8-5(2)7;1-2/h3H2,1-2H3;2H,1H3.
What are the key properties of methanol;2-oxopropyl acetate?
methanol;2-oxopropyl acetate has a molecular weight of 148.16 g/mol, XLogP of -0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-oxopropyl acetate is sourced from PubChem (CID 174729097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).