About 2-oxopropyl acetate;bis(vanadium)
2-oxopropyl acetate;bis(vanadium) (PubChem CID 175077929) has the molecular formula C5H8O3V2
and a molecular weight of 218.00 g/mol. Its IUPAC name is 2-oxopropyl acetate;bis(vanadium).
Molecular Properties
| Compound Name | 2-oxopropyl acetate;bis(vanadium) |
| PubChem CID | 175077929 |
| Molecular Formula | C5H8O3V2 |
| Molecular Weight | 218.00 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | 2-oxopropyl acetate;bis(vanadium) |
| SMILES | CC(=O)COC(C)=O.[V].[V] |
| InChI | InChI=1S/C5H8O3.2V/c1-4(6)3-8-5(2)7;;/h3H2,1-2H3;; |
| InChIKey | KOQJKZOAJYELNT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.00 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxopropyl acetate;bis(vanadium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl acetate;bis(vanadium)?
The IUPAC name of 2-oxopropyl acetate;bis(vanadium) (CID 175077929) is 2-oxopropyl acetate;bis(vanadium).
What is the SMILES notation for 2-oxopropyl acetate;bis(vanadium)?
The canonical SMILES for 2-oxopropyl acetate;bis(vanadium) is CC(=O)COC(C)=O.[V].[V].
What is the InChIKey of 2-oxopropyl acetate;bis(vanadium)?
The InChIKey is KOQJKZOAJYELNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.2V/c1-4(6)3-8-5(2)7;;/h3H2,1-2H3;;.
What are the key properties of 2-oxopropyl acetate;bis(vanadium)?
2-oxopropyl acetate;bis(vanadium) has a molecular weight of 218.00 g/mol, XLogP of 0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl acetate;bis(vanadium) is sourced from PubChem (CID 175077929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).