About bis(2-acetyloxyacetic acid);palladium
bis(2-acetyloxyacetic acid);palladium (PubChem CID 156697217) has the molecular formula C8H12O8Pd
and a molecular weight of 342.60 g/mol. Its IUPAC name is bis(2-acetyloxyacetic acid);palladium.
Molecular Properties
| Compound Name | bis(2-acetyloxyacetic acid);palladium |
| PubChem CID | 156697217 |
| Molecular Formula | C8H12O8Pd |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | bis(2-acetyloxyacetic acid);palladium |
| SMILES | CC(=O)OCC(=O)O.CC(=O)OCC(=O)O.[Pd] |
| InChI | InChI=1S/2C4H6O4.Pd/c2*1-3(5)8-2-4(6)7;/h2*2H2,1H3,(H,6,7); |
| InChIKey | JDSINPBQHYOAPF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-acetyloxyacetic acid);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-acetyloxyacetic acid);palladium?
The IUPAC name of bis(2-acetyloxyacetic acid);palladium (CID 156697217) is bis(2-acetyloxyacetic acid);palladium.
What is the SMILES notation for bis(2-acetyloxyacetic acid);palladium?
The canonical SMILES for bis(2-acetyloxyacetic acid);palladium is CC(=O)OCC(=O)O.CC(=O)OCC(=O)O.[Pd].
What is the InChIKey of bis(2-acetyloxyacetic acid);palladium?
The InChIKey is JDSINPBQHYOAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H6O4.Pd/c2*1-3(5)8-2-4(6)7;/h2*2H2,1H3,(H,6,7);.
What are the key properties of bis(2-acetyloxyacetic acid);palladium?
bis(2-acetyloxyacetic acid);palladium has a molecular weight of 342.60 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-acetyloxyacetic acid);palladium is sourced from PubChem (CID 156697217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).