About (4-acetyloxy-2,3-dioxobutyl) acetate
(4-acetyloxy-2,3-dioxobutyl) acetate (PubChem CID 10679601) has the molecular formula C8H10O6
and a molecular weight of 202.16 g/mol. Its IUPAC name is (4-acetyloxy-2,3-dioxobutyl) acetate.
Molecular Properties
| Compound Name | (4-acetyloxy-2,3-dioxobutyl) acetate |
| PubChem CID | 10679601 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (4-acetyloxy-2,3-dioxobutyl) acetate |
| SMILES | CC(=O)OCC(=O)C(=O)COC(C)=O |
| InChI | InChI=1S/C8H10O6/c1-5(9)13-3-7(11)8(12)4-14-6(2)10/h3-4H2,1-2H3 |
| InChIKey | FQXXTAPJOLVZAH-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyloxy-2,3-dioxobutyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxy-2,3-dioxobutyl) acetate?
The IUPAC name of (4-acetyloxy-2,3-dioxobutyl) acetate (CID 10679601) is (4-acetyloxy-2,3-dioxobutyl) acetate.
What is the SMILES notation for (4-acetyloxy-2,3-dioxobutyl) acetate?
The canonical SMILES for (4-acetyloxy-2,3-dioxobutyl) acetate is CC(=O)OCC(=O)C(=O)COC(C)=O.
What is the InChIKey of (4-acetyloxy-2,3-dioxobutyl) acetate?
The InChIKey is FQXXTAPJOLVZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O6/c1-5(9)13-3-7(11)8(12)4-14-6(2)10/h3-4H2,1-2H3.
What are the key properties of (4-acetyloxy-2,3-dioxobutyl) acetate?
(4-acetyloxy-2,3-dioxobutyl) acetate has a molecular weight of 202.16 g/mol, XLogP of -0.75, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxy-2,3-dioxobutyl) acetate is sourced from PubChem (CID 10679601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).