About (3-iodo-2-oxopropyl) acetate
(3-iodo-2-oxopropyl) acetate (PubChem CID 54597592) has the molecular formula C5H7IO3
and a molecular weight of 242.01 g/mol. Its IUPAC name is (3-iodo-2-oxopropyl) acetate.
Molecular Properties
| Compound Name | (3-iodo-2-oxopropyl) acetate |
| PubChem CID | 54597592 |
| Molecular Formula | C5H7IO3 |
| Molecular Weight | 242.01 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | (3-iodo-2-oxopropyl) acetate |
| SMILES | CC(=O)OCC(=O)CI |
| InChI | InChI=1S/C5H7IO3/c1-4(7)9-3-5(8)2-6/h2-3H2,1H3 |
| InChIKey | LPNHMAMFLUVJMO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.01 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-iodo-2-oxopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodo-2-oxopropyl) acetate?
The IUPAC name of (3-iodo-2-oxopropyl) acetate (CID 54597592) is (3-iodo-2-oxopropyl) acetate.
What is the SMILES notation for (3-iodo-2-oxopropyl) acetate?
The canonical SMILES for (3-iodo-2-oxopropyl) acetate is CC(=O)OCC(=O)CI.
What is the InChIKey of (3-iodo-2-oxopropyl) acetate?
The InChIKey is LPNHMAMFLUVJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IO3/c1-4(7)9-3-5(8)2-6/h2-3H2,1H3.
What are the key properties of (3-iodo-2-oxopropyl) acetate?
(3-iodo-2-oxopropyl) acetate has a molecular weight of 242.01 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodo-2-oxopropyl) acetate is sourced from PubChem (CID 54597592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).