About 2-ethoxyacetic acid;2-ethoxyethyl acetate
2-ethoxyacetic acid;2-ethoxyethyl acetate (PubChem CID 175733176) has the molecular formula C10H20O6
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-ethoxyacetic acid;2-ethoxyethyl acetate.
Molecular Properties
| Compound Name | 2-ethoxyacetic acid;2-ethoxyethyl acetate |
| PubChem CID | 175733176 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-ethoxyacetic acid;2-ethoxyethyl acetate |
| SMILES | CCOCC(=O)O.CCOCCOC(C)=O |
| InChI | InChI=1S/C6H12O3.C4H8O3/c1-3-8-4-5-9-6(2)7;1-2-7-3-4(5)6/h3-5H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | WXRPCDGJEVZDKT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyacetic acid;2-ethoxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyacetic acid;2-ethoxyethyl acetate?
The IUPAC name of 2-ethoxyacetic acid;2-ethoxyethyl acetate (CID 175733176) is 2-ethoxyacetic acid;2-ethoxyethyl acetate.
What is the SMILES notation for 2-ethoxyacetic acid;2-ethoxyethyl acetate?
The canonical SMILES for 2-ethoxyacetic acid;2-ethoxyethyl acetate is CCOCC(=O)O.CCOCCOC(C)=O.
What is the InChIKey of 2-ethoxyacetic acid;2-ethoxyethyl acetate?
The InChIKey is WXRPCDGJEVZDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C4H8O3/c1-3-8-4-5-9-6(2)7;1-2-7-3-4(5)6/h3-5H2,1-2H3;2-3H2,1H3,(H,5,6).
What are the key properties of 2-ethoxyacetic acid;2-ethoxyethyl acetate?
2-ethoxyacetic acid;2-ethoxyethyl acetate has a molecular weight of 236.26 g/mol, XLogP of 0.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyacetic acid;2-ethoxyethyl acetate is sourced from PubChem (CID 175733176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).