C12H16O9 — CID 59899531
methyl (2R,3R)-2,3,5-triacetyloxy-4-oxopentanoate (PubChem CID 59899531) has the molecular formula C12H16O9 and a molecular weight of 304.25 g/mol. Its IUPAC name is methyl (2R,3R)-2,3,5-triacetyloxy-4-oxopentanoate.
| Compound Name | methyl (2R,3R)-2,3,5-triacetyloxy-4-oxopentanoate |
|---|---|
| PubChem CID | 59899531 |
| Molecular Formula | C12H16O9 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl (2R,3R)-2,3,5-triacetyloxy-4-oxopentanoate |
| SMILES | COC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)COC(C)=O |
| InChI | InChI=1S/C12H16O9/c1-6(13)19-5-9(16)10(20-7(2)14)11(12(17)18-4)21-8(3)15/h10-11H,5H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | BRUMDOIXZOWYNI-WDEREUQCSA-N |
| XLogP | -0.85 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|