C12H19NO7 — CID 10968213
dimethyl 2-[[(2S)-2-acetyloxy-3-methylbutanoyl]amino]propanedioate (PubChem CID 10968213) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is dimethyl 2-[[(2S)-2-acetyloxy-3-methylbutanoyl]amino]propanedioate.
| Compound Name | dimethyl 2-[[(2S)-2-acetyloxy-3-methylbutanoyl]amino]propanedioate |
|---|---|
| PubChem CID | 10968213 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | dimethyl 2-[[(2S)-2-acetyloxy-3-methylbutanoyl]amino]propanedioate |
| SMILES | COC(=O)C(NC(=O)[C@@H](OC(C)=O)C(C)C)C(=O)OC |
| InChI | InChI=1S/C12H19NO7/c1-6(2)9(20-7(3)14)10(15)13-8(11(16)18-4)12(17)19-5/h6,8-9H,1-5H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | CYHYYJKXAKVYTP-VIFPVBQESA-N |
| XLogP | -0.60 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|