C9H12O8 — CID 2007459
(2R,3R)-2,3-diacetyloxy-4-methoxy-4-oxobutanoic acid (PubChem CID 2007459) has the molecular formula C9H12O8 and a molecular weight of 248.19 g/mol. Its IUPAC name is (2R,3R)-2,3-diacetyloxy-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2R,3R)-2,3-diacetyloxy-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 2007459 |
| Molecular Formula | C9H12O8 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (2R,3R)-2,3-diacetyloxy-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H12O8/c1-4(10)16-6(8(12)13)7(9(14)15-3)17-5(2)11/h6-7H,1-3H3,(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | GVCSACPSWHMFIU-RNFRBKRXSA-N |
| XLogP | -0.89 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|