C14H18O12 — CID 99723141
(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxyhexanedioic acid (PubChem CID 99723141) has the molecular formula C14H18O12 and a molecular weight of 378.29 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2,3,4,5-tetraacetyloxyhexanedioic acid.
| Compound Name | (2R,3R,4R,5S)-2,3,4,5-tetraacetyloxyhexanedioic acid |
|---|---|
| PubChem CID | 99723141 |
| Molecular Formula | C14H18O12 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (2R,3R,4R,5S)-2,3,4,5-tetraacetyloxyhexanedioic acid |
| SMILES | CC(=O)O[C@H]([C@@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)O)[C@H](OC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H18O12/c1-5(15)23-9(11(13(19)20)25-7(3)17)10(24-6(2)16)12(14(21)22)26-8(4)18/h9-12H,1-4H3,(H,19,20)(H,21,22)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | RITGLGZGMSTJIQ-KKOKHZNYSA-N |
| XLogP | -1.12 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|