C30H36N2O10 — CID 4863601
[2,4,5-triacetyloxy-1,6-dioxo-1,6-bis(2-phenylethylamino)hexan-3-yl] acetate (PubChem CID 4863601) has the molecular formula C30H36N2O10 and a molecular weight of 584.62 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-1,6-dioxo-1,6-bis(2-phenylethylamino)hexan-3-yl] acetate.
| Compound Name | [2,4,5-triacetyloxy-1,6-dioxo-1,6-bis(2-phenylethylamino)hexan-3-yl] acetate |
|---|---|
| PubChem CID | 4863601 |
| Molecular Formula | C30H36N2O10 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [2,4,5-triacetyloxy-1,6-dioxo-1,6-bis(2-phenylethylamino)hexan-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)NCCc1ccccc1)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C30H36N2O10/c1-19(33)39-25(27(41-21(3)35)29(37)31-17-15-23-11-7-5-8-12-23)26(40-20(2)34)28(42-22(4)36)30(38)32-18-16-24-13-9-6-10-14-24/h5-14,25-28H,15-18H2,1-4H3,(H,31,37)(H,32,38) |
| InChIKey | IKGYDSRGXQLAPC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|