C18H22BrNO7 — CID 101481391
[(2S,3S,4R)-3,4-diacetyloxy-5-(benzylamino)-1-bromo-5-oxopentan-2-yl] acetate (PubChem CID 101481391) has the molecular formula C18H22BrNO7 and a molecular weight of 444.28 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4-diacetyloxy-5-(benzylamino)-1-bromo-5-oxopentan-2-yl] acetate.
| Compound Name | [(2S,3S,4R)-3,4-diacetyloxy-5-(benzylamino)-1-bromo-5-oxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 101481391 |
| Molecular Formula | C18H22BrNO7 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | [(2S,3S,4R)-3,4-diacetyloxy-5-(benzylamino)-1-bromo-5-oxopentan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@@H](CBr)OC(C)=O)[C@@H](OC(C)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H22BrNO7/c1-11(21)25-15(9-19)16(26-12(2)22)17(27-13(3)23)18(24)20-10-14-7-5-4-6-8-14/h4-8,15-17H,9-10H2,1-3H3,(H,20,24)/t15-,16-,17-/m1/s1 |
| InChIKey | UDTOCLGCEXPWMI-BRWVUGGUSA-N |
| XLogP | 1.49 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|