C15H22N2O4 — CID 166791710
[1-(benzylamino)-3-hydroxy-4,4-dimethyl-1-oxopentan-2-yl] carbamate (PubChem CID 166791710) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is [1-(benzylamino)-3-hydroxy-4,4-dimethyl-1-oxopentan-2-yl] carbamate.
| Compound Name | [1-(benzylamino)-3-hydroxy-4,4-dimethyl-1-oxopentan-2-yl] carbamate |
|---|---|
| PubChem CID | 166791710 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [1-(benzylamino)-3-hydroxy-4,4-dimethyl-1-oxopentan-2-yl] carbamate |
| SMILES | CC(C)(C)C(O)C(OC(N)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)12(18)11(21-14(16)20)13(19)17-9-10-7-5-4-6-8-10/h4-8,11-12,18H,9H2,1-3H3,(H2,16,20)(H,17,19) |
| InChIKey | NASPYNNGZSDNFP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |