C17H19NO4 — CID 647241
[1-(benzylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate (PubChem CID 647241) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [1-(benzylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate.
| Compound Name | [1-(benzylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 647241 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [1-(benzylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate |
| SMILES | CC(C)C(OC(=O)c1ccco1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-12(2)15(22-17(20)14-9-6-10-21-14)16(19)18-11-13-7-4-3-5-8-13/h3-10,12,15H,11H2,1-2H3,(H,18,19) |
| InChIKey | WPBDQYROWADUNT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |