C11H14N2O5 — CID 18080365
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate (PubChem CID 18080365) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 18080365 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] furan-2-carboxylate |
| SMILES | CC(C)C(OC(=O)c1ccco1)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H14N2O5/c1-6(2)8(9(14)13-11(12)16)18-10(15)7-4-3-5-17-7/h3-6,8H,1-2H3,(H3,12,13,14,16) |
| InChIKey | XQMYUHAIQTVFSG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |