C19H16N2O4 — CID 51687865
[(1S)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl] furan-2-carboxylate (PubChem CID 51687865) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [(1S)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl] furan-2-carboxylate.
| Compound Name | [(1S)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 51687865 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [(1S)-2-(benzylamino)-2-oxo-1-pyridin-3-ylethyl] furan-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)NCc1ccccc1)c1cccnc1)c1ccco1 |
| InChI | InChI=1S/C19H16N2O4/c22-18(21-12-14-6-2-1-3-7-14)17(15-8-4-10-20-13-15)25-19(23)16-9-5-11-24-16/h1-11,13,17H,12H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | IXCGFDBOADEYMS-KRWDZBQOSA-N |
| XLogP | 2.89 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |