C25H22N4O3 — CID 22298699
N-[3-(benzylamino)-1-(furan-2-yl)-3-oxo-2-pyridin-3-ylpropyl]pyridine-2-carboxamide (PubChem CID 22298699) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[3-(benzylamino)-1-(furan-2-yl)-3-oxo-2-pyridin-3-ylpropyl]pyridine-2-carboxamide.
| Compound Name | N-[3-(benzylamino)-1-(furan-2-yl)-3-oxo-2-pyridin-3-ylpropyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22298699 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[3-(benzylamino)-1-(furan-2-yl)-3-oxo-2-pyridin-3-ylpropyl]pyridine-2-carboxamide |
| SMILES | O=C(NC(c1ccco1)C(C(=O)NCc1ccccc1)c1cccnc1)c1ccccn1 |
| InChI | InChI=1S/C25H22N4O3/c30-24(20-11-4-5-14-27-20)29-23(21-12-7-15-32-21)22(19-10-6-13-26-17-19)25(31)28-16-18-8-2-1-3-9-18/h1-15,17,22-23H,16H2,(H,28,31)(H,29,30) |
| InChIKey | HPPYLOQAIIHLBC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |