C23H20N4O2S2 — CID 21156827
N-[3-(benzylamino)-3-oxo-1,2-dithiophen-2-ylpropyl]pyrazine-2-carboxamide (PubChem CID 21156827) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[3-(benzylamino)-3-oxo-1,2-dithiophen-2-ylpropyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-(benzylamino)-3-oxo-1,2-dithiophen-2-ylpropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 21156827 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[3-(benzylamino)-3-oxo-1,2-dithiophen-2-ylpropyl]pyrazine-2-carboxamide |
| SMILES | O=C(NC(c1cccs1)C(C(=O)NCc1ccccc1)c1cccs1)c1cnccn1 |
| InChI | InChI=1S/C23H20N4O2S2/c28-22(17-15-24-10-11-25-17)27-21(19-9-5-13-31-19)20(18-8-4-12-30-18)23(29)26-14-16-6-2-1-3-7-16/h1-13,15,20-21H,14H2,(H,26,29)(H,27,28) |
| InChIKey | YALZIILHFFKEGS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |