C15H15ClN4O3 — CID 6724624
N-[(2S)-1-[(4-chlorophenyl)methylamino]-3-hydroxy-1-oxopropan-2-yl]pyrazine-2-carboxamide (PubChem CID 6724624) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is N-[(2S)-1-[(4-chlorophenyl)methylamino]-3-hydroxy-1-oxopropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-[(4-chlorophenyl)methylamino]-3-hydroxy-1-oxopropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 6724624 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[(2S)-1-[(4-chlorophenyl)methylamino]-3-hydroxy-1-oxopropan-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)C(=O)NCc1ccc(Cl)cc1)c1cnccn1 |
| InChI | InChI=1S/C15H15ClN4O3/c16-11-3-1-10(2-4-11)7-19-14(22)13(9-21)20-15(23)12-8-17-5-6-18-12/h1-6,8,13,21H,7,9H2,(H,19,22)(H,20,23)/t13-/m0/s1 |
| InChIKey | PSIAYTGXRFJBSV-ZDUSSCGKSA-N |
| XLogP | 0.54 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |