C15H13F3N4O3 — CID 4623413
N-[3-hydroxy-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 4623413) has the molecular formula C15H13F3N4O3 and a molecular weight of 354.29 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[3-hydroxy-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 4623413 |
| Molecular Formula | C15H13F3N4O3 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC(CO)C(=O)Nc1cccc(C(F)(F)F)c1)c1cnccn1 |
| InChI | InChI=1S/C15H13F3N4O3/c16-15(17,18)9-2-1-3-10(6-9)21-14(25)12(8-23)22-13(24)11-7-19-4-5-20-11/h1-7,12,23H,8H2,(H,21,25)(H,22,24) |
| InChIKey | PGJSPUQMFNDHCV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |