C17H15N5O3 — CID 3652353
N-[3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]pyrazine-2-carboxamide (PubChem CID 3652353) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3652353 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC(CO)C(=O)Nc1ccc2ncccc2c1)c1cnccn1 |
| InChI | InChI=1S/C17H15N5O3/c23-10-15(22-16(24)14-9-18-6-7-20-14)17(25)21-12-3-4-13-11(8-12)2-1-5-19-13/h1-9,15,23H,10H2,(H,21,25)(H,22,24) |
| InChIKey | GJQQWUORRUMNBQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |